C14H22N2 — CID 143004803
ethane;1-methyl-2-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]-4,5-dihydroimidazole (PubChem CID 143004803) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;1-methyl-2-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]-4,5-dihydroimidazole.
| Compound Name | ethane;1-methyl-2-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 143004803 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;1-methyl-2-[(2E,4Z)-octa-2,4-dien-6-yn-2-yl]-4,5-dihydroimidazole |
| SMILES | CC.CC#C/C=C\C=C(/C)C1=NCCN1C |
| InChI | InChI=1S/C12H16N2.C2H6/c1-4-5-6-7-8-11(2)12-13-9-10-14(12)3;1-2/h6-8H,9-10H2,1-3H3;1-2H3/b7-6-,11-8+; |
| InChIKey | YUQCBQMQJKPBMV-DWROGWBBSA-N |
| XLogP | 2.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|