About 1,3-dimethyl-1,4-diazepan-2-one;ethane
1,3-dimethyl-1,4-diazepan-2-one;ethane (PubChem CID 143004866) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,3-dimethyl-1,4-diazepan-2-one;ethane.
Molecular Properties
| Compound Name | 1,3-dimethyl-1,4-diazepan-2-one;ethane |
| PubChem CID | 143004866 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | 1,3-dimethyl-1,4-diazepan-2-one;ethane |
| SMILES | CC.CC.CC1NCCCN(C)C1=O |
| InChI | InChI=1S/C7H14N2O.2C2H6/c1-6-7(10)9(2)5-3-4-8-6;2*1-2/h6,8H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | ZQIAOPWRESOTHY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-1,4-diazepan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,4-diazepan-2-one;ethane?
The IUPAC name of 1,3-dimethyl-1,4-diazepan-2-one;ethane (CID 143004866) is 1,3-dimethyl-1,4-diazepan-2-one;ethane.
What is the SMILES notation for 1,3-dimethyl-1,4-diazepan-2-one;ethane?
The canonical SMILES for 1,3-dimethyl-1,4-diazepan-2-one;ethane is CC.CC.CC1NCCCN(C)C1=O.
What is the InChIKey of 1,3-dimethyl-1,4-diazepan-2-one;ethane?
The InChIKey is ZQIAOPWRESOTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.2C2H6/c1-6-7(10)9(2)5-3-4-8-6;2*1-2/h6,8H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 1,3-dimethyl-1,4-diazepan-2-one;ethane?
1,3-dimethyl-1,4-diazepan-2-one;ethane has a molecular weight of 202.34 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,4-diazepan-2-one;ethane is sourced from PubChem (CID 143004866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).