C16H28BClO2 — CID 143005405
(2S,6R)-4-[(1S)-1-chloro-3-methylbutyl]-2,11,11-trimethyl-3,5-dioxa-4-boratricyclo[6.2.1.02,6]undecane (PubChem CID 143005405) has the molecular formula C16H28BClO2 and a molecular weight of 298.66 g/mol. Its IUPAC name is (2S,6R)-4-[(1S)-1-chloro-3-methylbutyl]-2,11,11-trimethyl-3,5-dioxa-4-boratricyclo[6.2.1.02,6]undecane.
| Compound Name | (2S,6R)-4-[(1S)-1-chloro-3-methylbutyl]-2,11,11-trimethyl-3,5-dioxa-4-boratricyclo[6.2.1.02,6]undecane |
|---|---|
| PubChem CID | 143005405 |
| Molecular Formula | C16H28BClO2 |
| Molecular Weight | 298.66 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2S,6R)-4-[(1S)-1-chloro-3-methylbutyl]-2,11,11-trimethyl-3,5-dioxa-4-boratricyclo[6.2.1.02,6]undecane |
| SMILES | CC(C)C[C@@H](Cl)B1O[C@@H]2CC3CCC(C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C16H28BClO2/c1-10(2)8-14(18)17-19-13-9-11-6-7-12(15(11,3)4)16(13,5)20-17/h10-14H,6-9H2,1-5H3/t11?,12?,13-,14-,16+/m1/s1 |
| InChIKey | UROCELDLKOICIY-IUNJVKSLSA-N |
| XLogP | 4.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.66 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|