C10H17NO3 — CID 143005650
methane;methoxymethane;1-methylpyrrole-2,4-dicarbaldehyde (PubChem CID 143005650) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is methane;methoxymethane;1-methylpyrrole-2,4-dicarbaldehyde.
| Compound Name | methane;methoxymethane;1-methylpyrrole-2,4-dicarbaldehyde |
|---|---|
| PubChem CID | 143005650 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | methane;methoxymethane;1-methylpyrrole-2,4-dicarbaldehyde |
| SMILES | C.COC.Cn1cc(C=O)cc1C=O |
| InChI | InChI=1S/C7H7NO2.C2H6O.CH4/c1-8-3-6(4-9)2-7(8)5-10;1-3-2;/h2-5H,1H3;1-2H3;1H4 |
| InChIKey | ZOYQARXRKWVOSM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|