C20H26F4N4O3 — CID 143006328
N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-buta-1,3-dien-2-yl-6-methyl-2H-1,4-oxazine-5-carboxamide (PubChem CID 143006328) has the molecular formula C20H26F4N4O3 and a molecular weight of 446.45 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-buta-1,3-dien-2-yl-6-methyl-2H-1,4-oxazine-5-carboxamide.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-buta-1,3-dien-2-yl-6-methyl-2H-1,4-oxazine-5-carboxamide |
|---|---|
| PubChem CID | 143006328 |
| Molecular Formula | C20H26F4N4O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-buta-1,3-dien-2-yl-6-methyl-2H-1,4-oxazine-5-carboxamide |
| SMILES | C=CC(=C)C1=NC(C(=O)NCCCC[C@H](N)C(=O)N2CC(F)(F)C(F)(F)C2)=C(C)OC1 |
| InChI | InChI=1S/C20H26F4N4O3/c1-4-12(2)15-9-31-13(3)16(27-15)17(29)26-8-6-5-7-14(25)18(30)28-10-19(21,22)20(23,24)11-28/h4,14H,1-2,5-11,25H2,3H3,(H,26,29)/t14-/m0/s1 |
| InChIKey | DBYPUFHHVNRZCE-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|