C11H14N2O — CID 143006481
2-[(E)-but-2-en-2-yl]-5-[(3E)-penta-1,3-dien-3-yl]-1,3,4-oxadiazole (PubChem CID 143006481) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-[(E)-but-2-en-2-yl]-5-[(3E)-penta-1,3-dien-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[(E)-but-2-en-2-yl]-5-[(3E)-penta-1,3-dien-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143006481 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-[(E)-but-2-en-2-yl]-5-[(3E)-penta-1,3-dien-3-yl]-1,3,4-oxadiazole |
| SMILES | C=C/C(=C\C)c1nnc(/C(C)=C/C)o1 |
| InChI | InChI=1S/C11H14N2O/c1-5-8(4)10-12-13-11(14-10)9(6-2)7-3/h5-7H,2H2,1,3-4H3/b8-5+,9-7+ |
| InChIKey | IZDJRSLGYRAENJ-OCIXRKKMSA-N |
| XLogP | 3.08 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|