C21H32N2O2 — CID 143007627
6-[2-[(4aR)-3-methyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-6-yl]propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 143007627) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 6-[2-[(4aR)-3-methyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-6-yl]propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-[2-[(4aR)-3-methyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-6-yl]propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 143007627 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 6-[2-[(4aR)-3-methyl-2,4,4a,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-6-yl]propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CN1COc2ccc(C(C)(C)C3CCC4OCN(C)C[C@H]4C3)cc2C1 |
| InChI | InChI=1S/C21H32N2O2/c1-21(2,17-5-7-19-15(9-17)11-22(3)13-24-19)18-6-8-20-16(10-18)12-23(4)14-25-20/h5,7,9,16,18,20H,6,8,10-14H2,1-4H3/t16-,18?,20?/m1/s1 |
| InChIKey | OPYIJQGBWMYVPI-PPDQVPDSSA-N |
| XLogP | 3.45 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |