C26H42N2 — CID 143007931
(Z)-N'-[2-[3-(4-cyclohexa-1,5-dien-1-ylbutan-2-yl)cyclobutyl]ethyl]-N,2-bis(ethenyl)but-2-enimidamide;ethane (PubChem CID 143007931) has the molecular formula C26H42N2 and a molecular weight of 382.64 g/mol. Its IUPAC name is (Z)-N'-[2-[3-(4-cyclohexa-1,5-dien-1-ylbutan-2-yl)cyclobutyl]ethyl]-N,2-bis(ethenyl)but-2-enimidamide;ethane.
| Compound Name | (Z)-N'-[2-[3-(4-cyclohexa-1,5-dien-1-ylbutan-2-yl)cyclobutyl]ethyl]-N,2-bis(ethenyl)but-2-enimidamide;ethane |
|---|---|
| PubChem CID | 143007931 |
| Molecular Formula | C26H42N2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (Z)-N'-[2-[3-(4-cyclohexa-1,5-dien-1-ylbutan-2-yl)cyclobutyl]ethyl]-N,2-bis(ethenyl)but-2-enimidamide;ethane |
| SMILES | C=CNC(=N\CCC1CC(C(C)CCC2=CCCC=C2)C1)/C(C=C)=C\C.CC |
| InChI | InChI=1S/C24H36N2.C2H6/c1-5-22(6-2)24(25-7-3)26-16-15-21-17-23(18-21)19(4)13-14-20-11-9-8-10-12-20;1-2/h5-7,9,11-12,19,21,23H,1,3,8,10,13-18H2,2,4H3,(H,25,26);1-2H3/b22-6-; |
| InChIKey | ITDULAUZHDWVDZ-GBDKFIHCSA-N |
| XLogP | 7.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|