About N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol
N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol (PubChem CID 143007954) has the molecular formula C19H24FN5O
and a molecular weight of 357.43 g/mol. Its IUPAC name is N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol.
Molecular Properties
| Compound Name | N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol |
| PubChem CID | 143007954 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol |
| SMILES | Cc1ccc(CCO)cc1.FC1CCC(Nc2ncnc3[nH]ncc23)C1 |
| InChI | InChI=1S/C10H12FN5.C9H12O/c11-6-1-2-7(3-6)15-9-8-4-14-16-10(8)13-5-12-9;1-8-2-4-9(5-3-8)6-7-10/h4-7H,1-3H2,(H2,12,13,14,15,16);2-5,10H,6-7H2,1H3 |
| InChIKey | AEHJNDMUPICUSP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol?
The IUPAC name of N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol (CID 143007954) is N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol.
What is the SMILES notation for N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol?
The canonical SMILES for N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol is Cc1ccc(CCO)cc1.FC1CCC(Nc2ncnc3[nH]ncc23)C1.
What is the InChIKey of N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol?
The InChIKey is AEHJNDMUPICUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN5.C9H12O/c11-6-1-2-7(3-6)15-9-8-4-14-16-10(8)13-5-12-9;1-8-2-4-9(5-3-8)6-7-10/h4-7H,1-3H2,(H2,12,13,14,15,16);2-5,10H,6-7H2,1H3.
What are the key properties of N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol?
N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol has a molecular weight of 357.43 g/mol, XLogP of 3.19, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorocyclopentyl)-1H-pyrazolo[5,4-d]pyrimidin-4-amine;2-(4-methylphenyl)ethanol is sourced from PubChem (CID 143007954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).