About N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide
N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide (PubChem CID 143008160) has the molecular formula C12H21N5
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide.
Molecular Properties
| Compound Name | N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide |
| PubChem CID | 143008160 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide |
| SMILES | [H]/N=C/C(=C)/C(=N\C1CCCCC1)N/C=N\CN |
| InChI | InChI=1S/C12H21N5/c1-10(7-13)12(16-9-15-8-14)17-11-5-3-2-4-6-11/h7,9,11,13H,1-6,8,14H2,(H,15,16,17)/b13-7+ |
| InChIKey | LWMGRSBOVNEJEV-NTUHNPAUSA-N |
| XLogP | 1.46 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide?
The IUPAC name of N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide (CID 143008160) is N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide.
What is the SMILES notation for N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide?
The canonical SMILES for N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide is [H]/N=C/C(=C)/C(=N\C1CCCCC1)N/C=N\CN.
What is the InChIKey of N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide?
The InChIKey is LWMGRSBOVNEJEV-NTUHNPAUSA-N. The full InChI is InChI=1S/C12H21N5/c1-10(7-13)12(16-9-15-8-14)17-11-5-3-2-4-6-11/h7,9,11,13H,1-6,8,14H2,(H,15,16,17)/b13-7+.
What are the key properties of N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide?
N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide has a molecular weight of 235.33 g/mol, XLogP of 1.46, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-aminomethyliminomethyl]-N'-cyclohexyl-2-methanimidoylprop-2-enimidamide is sourced from PubChem (CID 143008160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).