C21H33N5O2 — CID 143008363
1-[4-(cyclopropylmethylamino)oxybutyl]-2-(ethoxymethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine (PubChem CID 143008363) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethylamino)oxybutyl]-2-(ethoxymethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[4-(cyclopropylmethylamino)oxybutyl]-2-(ethoxymethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 143008363 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 1-[4-(cyclopropylmethylamino)oxybutyl]-2-(ethoxymethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCOCc1nc2c(N)nc3c(c2n1CCCCONCC1CC1)CCCC3 |
| InChI | InChI=1S/C21H33N5O2/c1-2-27-14-18-25-19-20(16-7-3-4-8-17(16)24-21(19)22)26(18)11-5-6-12-28-23-13-15-9-10-15/h15,23H,2-14H2,1H3,(H2,22,24) |
| InChIKey | MKRGDHKVGPETBL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|