C19H17BrF2N2O4 — CID 143008383
5-[[(2Z,4Z)-5-bromo-4-[(2,4-difluorophenyl)methoxy]hexa-2,4-dien-2-yl]-formylamino]furan-2-carboxamide (PubChem CID 143008383) has the molecular formula C19H17BrF2N2O4 and a molecular weight of 455.26 g/mol. Its IUPAC name is 5-[[(2Z,4Z)-5-bromo-4-[(2,4-difluorophenyl)methoxy]hexa-2,4-dien-2-yl]-formylamino]furan-2-carboxamide.
| Compound Name | 5-[[(2Z,4Z)-5-bromo-4-[(2,4-difluorophenyl)methoxy]hexa-2,4-dien-2-yl]-formylamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 143008383 |
| Molecular Formula | C19H17BrF2N2O4 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 5-[[(2Z,4Z)-5-bromo-4-[(2,4-difluorophenyl)methoxy]hexa-2,4-dien-2-yl]-formylamino]furan-2-carboxamide |
| SMILES | C/C(=C/C(OCc1ccc(F)cc1F)=C(\C)Br)N(C=O)c1ccc(C(N)=O)o1 |
| InChI | InChI=1S/C19H17BrF2N2O4/c1-11(24(10-25)18-6-5-16(28-18)19(23)26)7-17(12(2)20)27-9-13-3-4-14(21)8-15(13)22/h3-8,10H,9H2,1-2H3,(H2,23,26)/b11-7-,17-12- |
| InChIKey | SLOQJLGJXNGYMN-HZYODZECSA-N |
| XLogP | 4.37 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|