C18H17BrF2N4O2 — CID 143008608
N-[(2Z,4Z)-5-amino-5-bromo-4-[(2,4-difluorophenyl)methoxy]penta-2,4-dien-2-yl]-N-(pyrazin-2-ylmethyl)formamide (PubChem CID 143008608) has the molecular formula C18H17BrF2N4O2 and a molecular weight of 439.26 g/mol. Its IUPAC name is N-[(2Z,4Z)-5-amino-5-bromo-4-[(2,4-difluorophenyl)methoxy]penta-2,4-dien-2-yl]-N-(pyrazin-2-ylmethyl)formamide.
| Compound Name | N-[(2Z,4Z)-5-amino-5-bromo-4-[(2,4-difluorophenyl)methoxy]penta-2,4-dien-2-yl]-N-(pyrazin-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 143008608 |
| Molecular Formula | C18H17BrF2N4O2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-[(2Z,4Z)-5-amino-5-bromo-4-[(2,4-difluorophenyl)methoxy]penta-2,4-dien-2-yl]-N-(pyrazin-2-ylmethyl)formamide |
| SMILES | C/C(=C/C(OCc1ccc(F)cc1F)=C(\N)Br)N(C=O)Cc1cnccn1 |
| InChI | InChI=1S/C18H17BrF2N4O2/c1-12(25(11-26)9-15-8-23-4-5-24-15)6-17(18(19)22)27-10-13-2-3-14(20)7-16(13)21/h2-8,11H,9-10,22H2,1H3/b12-6-,18-17+ |
| InChIKey | UPPYJNYWKWBADX-PUUDOQDYSA-N |
| XLogP | 3.36 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|