C19H16FNO4S — CID 143009168
2-[4-(4-fluorophenyl)-5-[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]-1,3-oxazol-2-yl]acetic acid (PubChem CID 143009168) has the molecular formula C19H16FNO4S and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-5-[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]-1,3-oxazol-2-yl]acetic acid.
| Compound Name | 2-[4-(4-fluorophenyl)-5-[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]-1,3-oxazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 143009168 |
| Molecular Formula | C19H16FNO4S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-5-[4-(methyl-methylidene-oxo-λ6-sulfanyl)phenyl]-1,3-oxazol-2-yl]acetic acid |
| SMILES | C=S(C)(=O)c1ccc(-c2oc(CC(=O)O)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H16FNO4S/c1-26(2,24)15-9-5-13(6-10-15)19-18(12-3-7-14(20)8-4-12)21-16(25-19)11-17(22)23/h3-10H,1,11H2,2H3,(H,22,23) |
| InChIKey | HQXOLKRKNMSUML-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|