C18H24F3N3O2S — CID 143009184
4-[2-(6-methylheptan-3-yl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (PubChem CID 143009184) has the molecular formula C18H24F3N3O2S and a molecular weight of 403.47 g/mol. Its IUPAC name is 4-[2-(6-methylheptan-3-yl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-(6-methylheptan-3-yl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 143009184 |
| Molecular Formula | C18H24F3N3O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[2-(6-methylheptan-3-yl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| SMILES | CCC(CCC(C)C)c1nc(C(F)(F)F)cn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H24F3N3O2S/c1-4-13(6-5-12(2)3)17-23-16(18(19,20)21)11-24(17)14-7-9-15(10-8-14)27(22,25)26/h7-13H,4-6H2,1-3H3,(H2,22,25,26) |
| InChIKey | HBEANRRIYJKYIL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |