About 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol
2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143009440) has the molecular formula C15H24N2O5
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol.
Molecular Properties
| Compound Name | 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol |
| PubChem CID | 143009440 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol |
| SMILES | Cc1c(OC2CC(O)CC(CO)O2)nn(C2CCOC2)c1C |
| InChI | InChI=1S/C15H24N2O5/c1-9-10(2)17(11-3-4-20-8-11)16-15(9)22-14-6-12(19)5-13(7-18)21-14/h11-14,18-19H,3-8H2,1-2H3 |
| InChIKey | KABIMGUDIYSHHE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol?
The IUPAC name of 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol (CID 143009440) is 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol.
What is the SMILES notation for 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol?
The canonical SMILES for 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol is Cc1c(OC2CC(O)CC(CO)O2)nn(C2CCOC2)c1C.
What is the InChIKey of 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol?
The InChIKey is KABIMGUDIYSHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O5/c1-9-10(2)17(11-3-4-20-8-11)16-15(9)22-14-6-12(19)5-13(7-18)21-14/h11-14,18-19H,3-8H2,1-2H3.
What are the key properties of 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol?
2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol has a molecular weight of 312.37 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethyl-1-(oxolan-3-yl)pyrazol-3-yl]oxy-6-(hydroxymethyl)oxan-4-ol is sourced from PubChem (CID 143009440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).