C31H54N2O8 — CID 143009461
[6-[4,5-dimethyl-1-(oxan-4-yl)pyrazol-3-yl]oxy-4-hydroxyoxan-2-yl]methyl ethyl carbonate;ethane;(2E,4Z)-2-ethoxy-5-methylhepta-2,4-diene (PubChem CID 143009461) has the molecular formula C31H54N2O8 and a molecular weight of 582.78 g/mol. Its IUPAC name is [6-[4,5-dimethyl-1-(oxan-4-yl)pyrazol-3-yl]oxy-4-hydroxyoxan-2-yl]methyl ethyl carbonate;ethane;(2E,4Z)-2-ethoxy-5-methylhepta-2,4-diene.
| Compound Name | [6-[4,5-dimethyl-1-(oxan-4-yl)pyrazol-3-yl]oxy-4-hydroxyoxan-2-yl]methyl ethyl carbonate;ethane;(2E,4Z)-2-ethoxy-5-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 143009461 |
| Molecular Formula | C31H54N2O8 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | [6-[4,5-dimethyl-1-(oxan-4-yl)pyrazol-3-yl]oxy-4-hydroxyoxan-2-yl]methyl ethyl carbonate;ethane;(2E,4Z)-2-ethoxy-5-methylhepta-2,4-diene |
| SMILES | CC.CCO/C(C)=C/C=C(/C)CC.CCOC(=O)OCC1CC(O)CC(Oc2nn(C3CCOCC3)c(C)c2C)O1 |
| InChI | InChI=1S/C19H30N2O7.C10H18O.C2H6/c1-4-25-19(23)26-11-16-9-15(22)10-17(27-16)28-18-12(2)13(3)21(20-18)14-5-7-24-8-6-14;1-5-9(3)7-8-10(4)11-6-2;1-2/h14-17,22H,4-11H2,1-3H3;7-8H,5-6H2,1-4H3;1-2H3/b;9-7-,10-8+; |
| InChIKey | SKQCHSLSDNVCQO-XTMYWTJQSA-N |
| XLogP | 6.58 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|