C22H31N5OS — CID 143009687
2-amino-4-[5-(butylaminomethyl)-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylethanamine (PubChem CID 143009687) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-amino-4-[5-(butylaminomethyl)-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylethanamine.
| Compound Name | 2-amino-4-[5-(butylaminomethyl)-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylethanamine |
|---|---|
| PubChem CID | 143009687 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-amino-4-[5-(butylaminomethyl)-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carbaldehyde;N-methylethanamine |
| SMILES | CCCCNCc1ccc(C)c(-c2nc(N)nc3sc(C=O)cc23)c1.CCNC |
| InChI | InChI=1S/C19H22N4OS.C3H9N/c1-3-4-7-21-10-13-6-5-12(2)15(8-13)17-16-9-14(11-24)25-18(16)23-19(20)22-17;1-3-4-2/h5-6,8-9,11,21H,3-4,7,10H2,1-2H3,(H2,20,22,23);4H,3H2,1-2H3 |
| InChIKey | FRBCBGZXNCKCKY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|