About 4-oxa-1-azaspiro[5.5]undeca-8,10-diene
4-oxa-1-azaspiro[5.5]undeca-8,10-diene (PubChem CID 143010370) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-oxa-1-azaspiro[5.5]undeca-8,10-diene.
Molecular Properties
| Compound Name | 4-oxa-1-azaspiro[5.5]undeca-8,10-diene |
| PubChem CID | 143010370 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-oxa-1-azaspiro[5.5]undeca-8,10-diene |
| SMILES | C1=CCC2(C=C1)COCCN2 |
| InChI | InChI=1S/C9H13NO/c1-2-4-9(5-3-1)8-11-7-6-10-9/h1-4,10H,5-8H2 |
| InChIKey | UDGPPGKJPLGQPN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxa-1-azaspiro[5.5]undeca-8,10-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxa-1-azaspiro[5.5]undeca-8,10-diene?
The IUPAC name of 4-oxa-1-azaspiro[5.5]undeca-8,10-diene (CID 143010370) is 4-oxa-1-azaspiro[5.5]undeca-8,10-diene.
What is the SMILES notation for 4-oxa-1-azaspiro[5.5]undeca-8,10-diene?
The canonical SMILES for 4-oxa-1-azaspiro[5.5]undeca-8,10-diene is C1=CCC2(C=C1)COCCN2.
What is the InChIKey of 4-oxa-1-azaspiro[5.5]undeca-8,10-diene?
The InChIKey is UDGPPGKJPLGQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-4-9(5-3-1)8-11-7-6-10-9/h1-4,10H,5-8H2.
What are the key properties of 4-oxa-1-azaspiro[5.5]undeca-8,10-diene?
4-oxa-1-azaspiro[5.5]undeca-8,10-diene has a molecular weight of 151.21 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxa-1-azaspiro[5.5]undeca-8,10-diene is sourced from PubChem (CID 143010370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).