C12H17N3O5 — CID 143010666
4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-enyloxolan-2-yl]pyrimidin-2-one (PubChem CID 143010666) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-enyloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-enyloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 143010666 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)-3-prop-1-enyloxolan-2-yl]pyrimidin-2-one |
| SMILES | CC=CC1(O)C(O)C(CO)OC1n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-2-4-12(19)9(17)7(6-16)20-10(12)15-5-3-8(13)14-11(15)18/h2-5,7,9-10,16-17,19H,6H2,1H3,(H2,13,14,18) |
| InChIKey | MGAYELHUERCAKL-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|