C18H23NO2 — CID 143010852
(S)-[(2S)-4-benzylmorpholin-2-yl]-cyclohexa-1,5-dien-1-ylmethanol (PubChem CID 143010852) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (S)-[(2S)-4-benzylmorpholin-2-yl]-cyclohexa-1,5-dien-1-ylmethanol.
| Compound Name | (S)-[(2S)-4-benzylmorpholin-2-yl]-cyclohexa-1,5-dien-1-ylmethanol |
|---|---|
| PubChem CID | 143010852 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (S)-[(2S)-4-benzylmorpholin-2-yl]-cyclohexa-1,5-dien-1-ylmethanol |
| SMILES | O[C@@H](C1=CCCC=C1)[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C18H23NO2/c20-18(16-9-5-2-6-10-16)17-14-19(11-12-21-17)13-15-7-3-1-4-8-15/h1,3-5,7-10,17-18,20H,2,6,11-14H2/t17-,18-/m0/s1 |
| InChIKey | WLVBJHNLOINBBS-ROUUACIJSA-N |
| XLogP | 2.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |