C14H26 — CID 143011520
(2R)-2,3-diethyl-2,6,6-trimethylbicyclo[3.1.1]heptane (PubChem CID 143011520) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (2R)-2,3-diethyl-2,6,6-trimethylbicyclo[3.1.1]heptane.
| Compound Name | (2R)-2,3-diethyl-2,6,6-trimethylbicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 143011520 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (2R)-2,3-diethyl-2,6,6-trimethylbicyclo[3.1.1]heptane |
| SMILES | CCC1CC2CC(C2(C)C)[C@]1(C)CC |
| InChI | InChI=1S/C14H26/c1-6-10-8-11-9-12(13(11,3)4)14(10,5)7-2/h10-12H,6-9H2,1-5H3/t10?,11?,12?,14-/m1/s1 |
| InChIKey | FBTZUQUDGRNMKM-GSPOMADGSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |