About CID 143011919
CID 143011919 (PubChem CID 143011919) has the molecular formula C29H55F2N6O6S+
and a molecular weight of 653.86 g/mol.
Molecular Properties
| Compound Name | CID 143011919 |
| PubChem CID | 143011919 |
| Molecular Formula | C29H55F2N6O6S+ |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | — |
| SMILES | CN(C[C@@H](NC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCC(C)(C)C)C(C)(C)C)C(C)(C)C)[S+](C)(=O)O |
| InChI | InChI=1S/C29H54F2N6O6S/c1-27(2,3)17-32-23(38)18(15-21(30)31)33-24(39)19-13-12-14-37(19)25(40)22(29(7,8)9)35-26(41)34-20(28(4,5)6)16-36(10)44(11,42)43/h18-22H,12-17H2,1-11H3,(H4-,32,33,34,35,38,39,41,42,43)/p+1/t18-,19-,20+,22+/m0/s1 |
| InChIKey | ISXZVSOBEXRAMK-ITTUMRLJSA-O |
| XLogP | 2.86 |
| TPSA | 160.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 143011919 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143011919?
The IUPAC name of CID 143011919 (CID 143011919) is not available.
What is the SMILES notation for CID 143011919?
The canonical SMILES for CID 143011919 is CN(C[C@@H](NC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCC(C)(C)C)C(C)(C)C)C(C)(C)C)[S+](C)(=O)O.
What is the InChIKey of CID 143011919?
The InChIKey is ISXZVSOBEXRAMK-ITTUMRLJSA-O. The full InChI is InChI=1S/C29H54F2N6O6S/c1-27(2,3)17-32-23(38)18(15-21(30)31)33-24(39)19-13-12-14-37(19)25(40)22(29(7,8)9)35-26(41)34-20(28(4,5)6)16-36(10)44(11,42)43/h18-22H,12-17H2,1-11H3,(H4-,32,33,34,35,38,39,41,42,43)/p+1/t18-,19-,20+,22+/m0/s1.
What are the key properties of CID 143011919?
CID 143011919 has a molecular weight of 653.86 g/mol, XLogP of 2.86, 12 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143011919 is sourced from PubChem (CID 143011919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).