About 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane
1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane (PubChem CID 143011981) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane.
Molecular Properties
| Compound Name | 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane |
| PubChem CID | 143011981 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane |
| SMILES | CC.CC(=O)N1CCCC1C(=O)F.FCF |
| InChI | InChI=1S/C7H10FNO2.C2H6.CH2F2/c1-5(10)9-4-2-3-6(9)7(8)11;1-2;2-1-3/h6H,2-4H2,1H3;1-2H3;1H2 |
| InChIKey | AUIZFBHWSIWAAG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane?
The IUPAC name of 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane (CID 143011981) is 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane.
What is the SMILES notation for 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane?
The canonical SMILES for 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane is CC.CC(=O)N1CCCC1C(=O)F.FCF.
What is the InChIKey of 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane?
The InChIKey is AUIZFBHWSIWAAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FNO2.C2H6.CH2F2/c1-5(10)9-4-2-3-6(9)7(8)11;1-2;2-1-3/h6H,2-4H2,1H3;1-2H3;1H2.
What are the key properties of 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane?
1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane has a molecular weight of 241.25 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetylpyrrolidine-2-carbonyl fluoride;difluoromethane;ethane is sourced from PubChem (CID 143011981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).