About 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane (PubChem CID 143012045) has the molecular formula C17H29NO
and a molecular weight of 263.43 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane |
| PubChem CID | 143012045 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane |
| SMILES | C=C/C=C\C1=C(C=C)C(=O)N(CC)CC1.CC.CC |
| InChI | InChI=1S/C13H17NO.2C2H6/c1-4-7-8-11-9-10-14(6-3)13(15)12(11)5-2;2*1-2/h4-5,7-8H,1-2,6,9-10H2,3H3;2*1-2H3/b8-7-;; |
| InChIKey | ZROFIJOGJWXEJW-OTMFCZTRSA-N |
| XLogP | 4.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane (CID 143012045) is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane is C=C/C=C\C1=C(C=C)C(=O)N(CC)CC1.CC.CC.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane?
The InChIKey is ZROFIJOGJWXEJW-OTMFCZTRSA-N. The full InChI is InChI=1S/C13H17NO.2C2H6/c1-4-7-8-11-9-10-14(6-3)13(15)12(11)5-2;2*1-2/h4-5,7-8H,1-2,6,9-10H2,3H3;2*1-2H3/b8-7-;;.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane?
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane has a molecular weight of 263.43 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-1-ethyl-2,3-dihydropyridin-6-one;ethane is sourced from PubChem (CID 143012045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).