About ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide
ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide (PubChem CID 143012057) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide |
| PubChem CID | 143012057 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide |
| SMILES | CC.CCN(C)C(=O)C(C)(C)CC=O |
| InChI | InChI=1S/C9H17NO2.C2H6/c1-5-10(4)8(12)9(2,3)6-7-11;1-2/h7H,5-6H2,1-4H3;1-2H3 |
| InChIKey | RWBHXKIOBUFKAS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide?
The IUPAC name of ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide (CID 143012057) is ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide.
What is the SMILES notation for ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide?
The canonical SMILES for ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide is CC.CCN(C)C(=O)C(C)(C)CC=O.
What is the InChIKey of ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide?
The InChIKey is RWBHXKIOBUFKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C2H6/c1-5-10(4)8(12)9(2,3)6-7-11;1-2/h7H,5-6H2,1-4H3;1-2H3.
What are the key properties of ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide?
ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide has a molecular weight of 201.31 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N,2,2-trimethyl-4-oxobutanamide is sourced from PubChem (CID 143012057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).