About ethane;5-fluoro-2-propylphenol
ethane;5-fluoro-2-propylphenol (PubChem CID 143012210) has the molecular formula C11H17FO
and a molecular weight of 184.25 g/mol. Its IUPAC name is ethane;5-fluoro-2-propylphenol.
Molecular Properties
| Compound Name | ethane;5-fluoro-2-propylphenol |
| PubChem CID | 143012210 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | ethane;5-fluoro-2-propylphenol |
| SMILES | CC.CCCc1ccc(F)cc1O |
| InChI | InChI=1S/C9H11FO.C2H6/c1-2-3-7-4-5-8(10)6-9(7)11;1-2/h4-6,11H,2-3H2,1H3;1-2H3 |
| InChIKey | MCKNKRCSTDWSDX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-fluoro-2-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-2-propylphenol?
The IUPAC name of ethane;5-fluoro-2-propylphenol (CID 143012210) is ethane;5-fluoro-2-propylphenol.
What is the SMILES notation for ethane;5-fluoro-2-propylphenol?
The canonical SMILES for ethane;5-fluoro-2-propylphenol is CC.CCCc1ccc(F)cc1O.
What is the InChIKey of ethane;5-fluoro-2-propylphenol?
The InChIKey is MCKNKRCSTDWSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO.C2H6/c1-2-3-7-4-5-8(10)6-9(7)11;1-2/h4-6,11H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;5-fluoro-2-propylphenol?
ethane;5-fluoro-2-propylphenol has a molecular weight of 184.25 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-2-propylphenol is sourced from PubChem (CID 143012210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).