C12H23NO2 — CID 143012237
ethane;3-ethyl-6-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 143012237) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is ethane;3-ethyl-6-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | ethane;3-ethyl-6-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 143012237 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethane;3-ethyl-6-methyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | CC.CC.CCN1C(=O)C2C(C)C2C1=O |
| InChI | InChI=1S/C8H11NO2.2C2H6/c1-3-9-7(10)5-4(2)6(5)8(9)11;2*1-2/h4-6H,3H2,1-2H3;2*1-2H3 |
| InChIKey | OLXHHYIAUSICBS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|