About N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide
N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide (PubChem CID 143012525) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide |
| PubChem CID | 143012525 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide |
| SMILES | CC(=O)Nc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C8H12N4O/c1-4-5(2)10-8(9)12-7(4)11-6(3)13/h1-3H3,(H3,9,10,11,12,13) |
| InChIKey | ZHYRTLBZXXCVNO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide?
The IUPAC name of N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide (CID 143012525) is N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide.
What is the SMILES notation for N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide?
The canonical SMILES for N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide is CC(=O)Nc1nc(N)nc(C)c1C.
What is the InChIKey of N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide?
The InChIKey is ZHYRTLBZXXCVNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-4-5(2)10-8(9)12-7(4)11-6(3)13/h1-3H3,(H3,9,10,11,12,13).
What are the key properties of N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide?
N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide has a molecular weight of 180.21 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-5,6-dimethylpyrimidin-4-yl)acetamide is sourced from PubChem (CID 143012525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).