C16H19ClN5O3+ — CID 143012687
(Z)-amino-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]phenyl]-(hydrazinylmethylidene)azanium (PubChem CID 143012687) has the molecular formula C16H19ClN5O3+ and a molecular weight of 364.81 g/mol. Its IUPAC name is (Z)-amino-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]phenyl]-(hydrazinylmethylidene)azanium.
| Compound Name | (Z)-amino-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]phenyl]-(hydrazinylmethylidene)azanium |
|---|---|
| PubChem CID | 143012687 |
| Molecular Formula | C16H19ClN5O3+ |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (Z)-amino-[3-[2-(5-chloro-2-methoxyanilino)-2-oxoethoxy]phenyl]-(hydrazinylmethylidene)azanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)COc1cccc(/[N+](N)=C/NN)c1 |
| InChI | InChI=1S/C16H18ClN5O3/c1-24-15-6-5-11(17)7-14(15)21-16(23)9-25-13-4-2-3-12(8-13)22(19)10-20-18/h2-8,10H,9,18-19H2,1H3,(H,21,23)/p+1 |
| InChIKey | VGMXJLJCKAJPSG-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|