About (6S)-1-methoxy-4,6-dimethylcyclohexene
(6S)-1-methoxy-4,6-dimethylcyclohexene (PubChem CID 143012915) has the molecular formula C9H16O
and a molecular weight of 140.23 g/mol. Its IUPAC name is (6S)-1-methoxy-4,6-dimethylcyclohexene.
Molecular Properties
| Compound Name | (6S)-1-methoxy-4,6-dimethylcyclohexene |
| PubChem CID | 143012915 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | (6S)-1-methoxy-4,6-dimethylcyclohexene |
| SMILES | COC1=CCC(C)C[C@@H]1C |
| InChI | InChI=1S/C9H16O/c1-7-4-5-9(10-3)8(2)6-7/h5,7-8H,4,6H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | QSHAYLARPVTXSN-MQWKRIRWSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6S)-1-methoxy-4,6-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-methoxy-4,6-dimethylcyclohexene?
The IUPAC name of (6S)-1-methoxy-4,6-dimethylcyclohexene (CID 143012915) is (6S)-1-methoxy-4,6-dimethylcyclohexene.
What is the SMILES notation for (6S)-1-methoxy-4,6-dimethylcyclohexene?
The canonical SMILES for (6S)-1-methoxy-4,6-dimethylcyclohexene is COC1=CCC(C)C[C@@H]1C.
What is the InChIKey of (6S)-1-methoxy-4,6-dimethylcyclohexene?
The InChIKey is QSHAYLARPVTXSN-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H16O/c1-7-4-5-9(10-3)8(2)6-7/h5,7-8H,4,6H2,1-3H3/t7?,8-/m0/s1.
What are the key properties of (6S)-1-methoxy-4,6-dimethylcyclohexene?
(6S)-1-methoxy-4,6-dimethylcyclohexene has a molecular weight of 140.23 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-methoxy-4,6-dimethylcyclohexene is sourced from PubChem (CID 143012915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).