C15H27NO2 — CID 143013206
3-(2,2-dimethylpropyl)-3,5-dimethyl-5-propan-2-ylpiperidine-2,6-dione (PubChem CID 143013206) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-3,5-dimethyl-5-propan-2-ylpiperidine-2,6-dione.
| Compound Name | 3-(2,2-dimethylpropyl)-3,5-dimethyl-5-propan-2-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 143013206 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-3,5-dimethyl-5-propan-2-ylpiperidine-2,6-dione |
| SMILES | CC(C)C1(C)CC(C)(CC(C)(C)C)C(=O)NC1=O |
| InChI | InChI=1S/C15H27NO2/c1-10(2)15(7)9-14(6,8-13(3,4)5)11(17)16-12(15)18/h10H,8-9H2,1-7H3,(H,16,17,18) |
| InChIKey | ULEULRLOJXZWOW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|