C31H54FN3O — CID 143013316
2-[1-(dipropylamino)ethenyl]-1-N,1-N-dimethylbenzene-1,4-diamine;ethane;1-(3-fluoro-4-methylphenyl)ethanone (PubChem CID 143013316) has the molecular formula C31H54FN3O and a molecular weight of 503.79 g/mol. Its IUPAC name is 2-[1-(dipropylamino)ethenyl]-1-N,1-N-dimethylbenzene-1,4-diamine;ethane;1-(3-fluoro-4-methylphenyl)ethanone.
| Compound Name | 2-[1-(dipropylamino)ethenyl]-1-N,1-N-dimethylbenzene-1,4-diamine;ethane;1-(3-fluoro-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 143013316 |
| Molecular Formula | C31H54FN3O |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 503.43 |
| IUPAC Name | 2-[1-(dipropylamino)ethenyl]-1-N,1-N-dimethylbenzene-1,4-diamine;ethane;1-(3-fluoro-4-methylphenyl)ethanone |
| SMILES | C=C(c1cc(N)ccc1N(C)C)N(CCC)CCC.CC.CC.CC.CC(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C16H27N3.C9H9FO.3C2H6/c1-6-10-19(11-7-2)13(3)15-12-14(17)8-9-16(15)18(4)5;1-6-3-4-8(7(2)11)5-9(6)10;3*1-2/h8-9,12H,3,6-7,10-11,17H2,1-2,4-5H3;3-5H,1-2H3;3*1-2H3 |
| InChIKey | OBXZIQUWBHNNRY-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|