C22H26N4 — CID 143013761
N',N'-dimethyl-N-(16-methyl-14,18-diazapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2,7,9,12(17),13,15-heptaen-13-yl)propane-1,3-diamine (PubChem CID 143013761) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-(16-methyl-14,18-diazapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2,7,9,12(17),13,15-heptaen-13-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(16-methyl-14,18-diazapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2,7,9,12(17),13,15-heptaen-13-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 143013761 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | N',N'-dimethyl-N-(16-methyl-14,18-diazapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1(11),2,7,9,12(17),13,15-heptaen-13-yl)propane-1,3-diamine |
| SMILES | Cc1cnc(NCCCN(C)C)c2c1[nH]c1c3c(ccc12)=CC1CC1C=3 |
| InChI | InChI=1S/C22H26N4/c1-13-12-24-22(23-7-4-8-26(2)3)19-17-6-5-14-9-15-10-16(15)11-18(14)21(17)25-20(13)19/h5-6,9,11-12,15-16,25H,4,7-8,10H2,1-3H3,(H,23,24) |
| InChIKey | RVTHGSFQPXGYOF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|