C11H9NO3 — CID 143013964
(E)-4-(3-nitrocyclohepta-1,2,4,6-tetraen-1-yl)but-3-en-2-one (PubChem CID 143013964) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is (E)-4-(3-nitrocyclohepta-1,2,4,6-tetraen-1-yl)but-3-en-2-one.
| Compound Name | (E)-4-(3-nitrocyclohepta-1,2,4,6-tetraen-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 143013964 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (E)-4-(3-nitrocyclohepta-1,2,4,6-tetraen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=C=C([N+](=O)[O-])C=CC=C1 |
| InChI | InChI=1S/C11H9NO3/c1-9(13)6-7-10-4-2-3-5-11(8-10)12(14)15/h2-7H,1H3/b7-6+ |
| InChIKey | FWMVLUUBPBNHOG-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|