C24H35Cl2FN4O2 — CID 143014287
N-(cyclopropylmethoxy)-6-[[(2E,4E)-4,6-dichlorohepta-2,4-dien-3-yl]amino]-7-fluoro-3-methylbenzimidazole-5-carboxamide;ethane (PubChem CID 143014287) has the molecular formula C24H35Cl2FN4O2 and a molecular weight of 501.47 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-6-[[(2E,4E)-4,6-dichlorohepta-2,4-dien-3-yl]amino]-7-fluoro-3-methylbenzimidazole-5-carboxamide;ethane.
| Compound Name | N-(cyclopropylmethoxy)-6-[[(2E,4E)-4,6-dichlorohepta-2,4-dien-3-yl]amino]-7-fluoro-3-methylbenzimidazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 143014287 |
| Molecular Formula | C24H35Cl2FN4O2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-(cyclopropylmethoxy)-6-[[(2E,4E)-4,6-dichlorohepta-2,4-dien-3-yl]amino]-7-fluoro-3-methylbenzimidazole-5-carboxamide;ethane |
| SMILES | C/C=C(Nc1c(C(=O)NOCC2CC2)cc2c(ncn2C)c1F)\C(Cl)=C/C(C)Cl.CC.CC |
| InChI | InChI=1S/C20H23Cl2FN4O2.2C2H6/c1-4-15(14(22)7-11(2)21)25-18-13(20(28)26-29-9-12-5-6-12)8-16-19(17(18)23)24-10-27(16)3;2*1-2/h4,7-8,10-12,25H,5-6,9H2,1-3H3,(H,26,28);2*1-2H3/b14-7+,15-4+;; |
| InChIKey | QXKPYLCQYVTXOL-LZIVXWBQSA-N |
| XLogP | 6.90 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|