C8H9N3 — CID 143014706
5-methylpyrazolo[1,5-a]pyridin-6-amine (PubChem CID 143014706) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 5-methylpyrazolo[1,5-a]pyridin-6-amine.
| Compound Name | 5-methylpyrazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 143014706 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 5-methylpyrazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1cc2ccnn2cc1N |
| InChI | InChI=1S/C8H9N3/c1-6-4-7-2-3-10-11(7)5-8(6)9/h2-5H,9H2,1H3 |
| InChIKey | QVKANPSJJGLFFU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |