C27H40N6O5S — CID 143014742
2-[(E)-[[3-[2-[[(Z)-8-aminoundec-7-enoyl]amino]ethylcarbamoyl]-1,2-dihydropyridin-6-yl]amino]methyliminomethyl]benzenesulfonic acid (PubChem CID 143014742) has the molecular formula C27H40N6O5S and a molecular weight of 560.72 g/mol. Its IUPAC name is 2-[(E)-[[3-[2-[[(Z)-8-aminoundec-7-enoyl]amino]ethylcarbamoyl]-1,2-dihydropyridin-6-yl]amino]methyliminomethyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-[[3-[2-[[(Z)-8-aminoundec-7-enoyl]amino]ethylcarbamoyl]-1,2-dihydropyridin-6-yl]amino]methyliminomethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143014742 |
| Molecular Formula | C27H40N6O5S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[(E)-[[3-[2-[[(Z)-8-aminoundec-7-enoyl]amino]ethylcarbamoyl]-1,2-dihydropyridin-6-yl]amino]methyliminomethyl]benzenesulfonic acid |
| SMILES | CCC/C(N)=C/CCCCCC(=O)NCCNC(=O)C1=CC=C(NC/N=C/c2ccccc2S(=O)(=O)O)NC1 |
| InChI | InChI=1S/C27H40N6O5S/c1-2-9-23(28)11-5-3-4-6-13-26(34)30-16-17-31-27(35)22-14-15-25(32-19-22)33-20-29-18-21-10-7-8-12-24(21)39(36,37)38/h7-8,10-12,14-15,18,32-33H,2-6,9,13,16-17,19-20,28H2,1H3,(H,30,34)(H,31,35)(H,36,37,38)/b23-11-,29-18+ |
| InChIKey | YPXOZLNNSDZVCF-WYCKEFRSSA-N |
| XLogP | 2.10 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|