About (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium
(E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium (PubChem CID 143014753) has the molecular formula C13H15N4O4S+
and a molecular weight of 323.35 g/mol. Its IUPAC name is (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium.
Molecular Properties
| Compound Name | (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium |
| PubChem CID | 143014753 |
| Molecular Formula | C13H15N4O4S+ |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium |
| SMILES | NC(=O)C1=CC=C(N/[NH+]=C/c2ccccc2S(=O)(=O)O)NC1 |
| InChI | InChI=1S/C13H14N4O4S/c14-13(18)10-5-6-12(15-7-10)17-16-8-9-3-1-2-4-11(9)22(19,20)21/h1-6,8,15,17H,7H2,(H2,14,18)(H,19,20,21)/p+1/b16-8+ |
| InChIKey | XXGRSVCANZNQKZ-LZYBPNLTSA-O |
| XLogP | -2.21 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium?
The IUPAC name of (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium (CID 143014753) is (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium.
What is the SMILES notation for (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium?
The canonical SMILES for (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium is NC(=O)C1=CC=C(N/[NH+]=C/c2ccccc2S(=O)(=O)O)NC1.
What is the InChIKey of (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium?
The InChIKey is XXGRSVCANZNQKZ-LZYBPNLTSA-O. The full InChI is InChI=1S/C13H14N4O4S/c14-13(18)10-5-6-12(15-7-10)17-16-8-9-3-1-2-4-11(9)22(19,20)21/h1-6,8,15,17H,7H2,(H2,14,18)(H,19,20,21)/p+1/b16-8+.
What are the key properties of (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium?
(E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium has a molecular weight of 323.35 g/mol, XLogP of -2.21, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-[(3-carbamoyl-1,2-dihydropyridin-6-yl)amino]-[(2-sulfophenyl)methylidene]azanium is sourced from PubChem (CID 143014753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).