C26H26F3N5O3 — CID 1430148
(5S,7R)-5-(1,3-benzodioxol-5-yl)-N-(2-piperidin-1-ylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1430148) has the molecular formula C26H26F3N5O3 and a molecular weight of 513.52 g/mol. Its IUPAC name is (5S,7R)-5-(1,3-benzodioxol-5-yl)-N-(2-piperidin-1-ylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(1,3-benzodioxol-5-yl)-N-(2-piperidin-1-ylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1430148 |
| Molecular Formula | C26H26F3N5O3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | (5S,7R)-5-(1,3-benzodioxol-5-yl)-N-(2-piperidin-1-ylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](c1ccc3c(c1)OCO3)N2 |
| InChI | InChI=1S/C26H26F3N5O3/c27-26(28,29)23-13-18(16-8-9-21-22(12-16)37-15-36-21)30-24-14-19(32-34(23)24)25(35)31-17-6-2-3-7-20(17)33-10-4-1-5-11-33/h2-3,6-9,12,14,18,23,30H,1,4-5,10-11,13,15H2,(H,31,35)/t18-,23+/m0/s1 |
| InChIKey | YXOKYOMNOFJMCU-FDDCHVKYSA-N |
| XLogP | 5.51 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |