About 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane
5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane (PubChem CID 143014971) has the molecular formula C18H35BrN2
and a molecular weight of 359.40 g/mol. Its IUPAC name is 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane.
Molecular Properties
| Compound Name | 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane |
| PubChem CID | 143014971 |
| Molecular Formula | C18H35BrN2 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane |
| SMILES | CC.CC.CC.CC.CCn1cc(C)c2nc(Br)ccc21 |
| InChI | InChI=1S/C10H11BrN2.4C2H6/c1-3-13-6-7(2)10-8(13)4-5-9(11)12-10;4*1-2/h4-6H,3H2,1-2H3;4*1-2H3 |
| InChIKey | JTRNFCSRAPJNKI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane?
The IUPAC name of 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane (CID 143014971) is 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane.
What is the SMILES notation for 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane?
The canonical SMILES for 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane is CC.CC.CC.CC.CCn1cc(C)c2nc(Br)ccc21.
What is the InChIKey of 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane?
The InChIKey is JTRNFCSRAPJNKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2.4C2H6/c1-3-13-6-7(2)10-8(13)4-5-9(11)12-10;4*1-2/h4-6H,3H2,1-2H3;4*1-2H3.
What are the key properties of 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane?
5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane has a molecular weight of 359.40 g/mol, XLogP of 7.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-ethyl-3-methylpyrrolo[3,2-b]pyridine;ethane is sourced from PubChem (CID 143014971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).