C20H23FO7 — CID 143015383
methyl 2-[(1E,7E)-7-fluoro-4,5-dihydroxy-6-(oxomethylidene)undeca-1,7-dienyl]-4,6-dihydroxybenzoate (PubChem CID 143015383) has the molecular formula C20H23FO7 and a molecular weight of 394.40 g/mol. Its IUPAC name is methyl 2-[(1E,7E)-7-fluoro-4,5-dihydroxy-6-(oxomethylidene)undeca-1,7-dienyl]-4,6-dihydroxybenzoate.
| Compound Name | methyl 2-[(1E,7E)-7-fluoro-4,5-dihydroxy-6-(oxomethylidene)undeca-1,7-dienyl]-4,6-dihydroxybenzoate |
|---|---|
| PubChem CID | 143015383 |
| Molecular Formula | C20H23FO7 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl 2-[(1E,7E)-7-fluoro-4,5-dihydroxy-6-(oxomethylidene)undeca-1,7-dienyl]-4,6-dihydroxybenzoate |
| SMILES | CCC/C=C(/F)C(=C=O)C(O)C(O)C/C=C/c1cc(O)cc(O)c1C(=O)OC |
| InChI | InChI=1S/C20H23FO7/c1-3-4-7-15(21)14(11-22)19(26)16(24)8-5-6-12-9-13(23)10-17(25)18(12)20(27)28-2/h5-7,9-10,16,19,23-26H,3-4,8H2,1-2H3/b6-5+,15-7+ |
| InChIKey | FDGFIGYDKDZNJO-CSNJMMPQSA-N |
| XLogP | 2.42 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|