About [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate
[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate (PubChem CID 143015562) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate.
Molecular Properties
| Compound Name | [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate |
| PubChem CID | 143015562 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate |
| SMILES | N#COc1ccc(OCCN2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C17H18N2O3/c18-13-22-17-6-5-16(14-3-1-2-4-15(14)17)21-12-9-19-7-10-20-11-8-19/h1-6H,7-12H2 |
| InChIKey | DTYJVEVKDBIBMJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate?
The IUPAC name of [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate (CID 143015562) is [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate.
What is the SMILES notation for [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate?
The canonical SMILES for [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate is N#COc1ccc(OCCN2CCOCC2)c2ccccc12.
What is the InChIKey of [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate?
The InChIKey is DTYJVEVKDBIBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c18-13-22-17-6-5-16(14-3-1-2-4-15(14)17)21-12-9-19-7-10-20-11-8-19/h1-6H,7-12H2.
What are the key properties of [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate?
[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate has a molecular weight of 298.34 g/mol, XLogP of 2.41, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-morpholin-4-ylethoxy)naphthalen-1-yl] cyanate is sourced from PubChem (CID 143015562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).