About 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one
1,5-dipyridin-4-ylpenta-1,4-diyn-3-one (PubChem CID 143015613) has the molecular formula C15H8N2O
and a molecular weight of 232.24 g/mol. Its IUPAC name is 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one.
Molecular Properties
| Compound Name | 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one |
| PubChem CID | 143015613 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one |
| SMILES | O=C(C#Cc1ccncc1)C#Cc1ccncc1 |
| InChI | InChI=1S/C15H8N2O/c18-15(3-1-13-5-9-16-10-6-13)4-2-14-7-11-17-12-8-14/h5-12H |
| InChIKey | VAEVHPOMNYQAJO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one?
The IUPAC name of 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one (CID 143015613) is 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one.
What is the SMILES notation for 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one?
The canonical SMILES for 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one is O=C(C#Cc1ccncc1)C#Cc1ccncc1.
What is the InChIKey of 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one?
The InChIKey is VAEVHPOMNYQAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N2O/c18-15(3-1-13-5-9-16-10-6-13)4-2-14-7-11-17-12-8-14/h5-12H.
What are the key properties of 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one?
1,5-dipyridin-4-ylpenta-1,4-diyn-3-one has a molecular weight of 232.24 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dipyridin-4-ylpenta-1,4-diyn-3-one is sourced from PubChem (CID 143015613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).