C13H18N2O4S — CID 143015649
N-hydroxy-5-[[(3E,5E)-5-methoxyhepta-3,5-dien-3-yl]sulfanylmethyl]-1,2-oxazole-3-carboxamide (PubChem CID 143015649) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-hydroxy-5-[[(3E,5E)-5-methoxyhepta-3,5-dien-3-yl]sulfanylmethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-hydroxy-5-[[(3E,5E)-5-methoxyhepta-3,5-dien-3-yl]sulfanylmethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 143015649 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-hydroxy-5-[[(3E,5E)-5-methoxyhepta-3,5-dien-3-yl]sulfanylmethyl]-1,2-oxazole-3-carboxamide |
| SMILES | C/C=C(\C=C(/CC)SCc1cc(C(=O)NO)no1)OC |
| InChI | InChI=1S/C13H18N2O4S/c1-4-9(18-3)6-11(5-2)20-8-10-7-12(15-19-10)13(16)14-17/h4,6-7,17H,5,8H2,1-3H3,(H,14,16)/b9-4+,11-6+ |
| InChIKey | GMEAXDRVUWMTCZ-WOARVNPXSA-N |
| XLogP | 2.87 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|