C19H25N3O3S — CID 143015680
2-(butylsulfinylamino)-N-[(1R)-1-(6-methoxy-3-pyridinyl)ethyl]benzamide (PubChem CID 143015680) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-(butylsulfinylamino)-N-[(1R)-1-(6-methoxy-3-pyridinyl)ethyl]benzamide.
| Compound Name | 2-(butylsulfinylamino)-N-[(1R)-1-(6-methoxy-3-pyridinyl)ethyl]benzamide |
|---|---|
| PubChem CID | 143015680 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(butylsulfinylamino)-N-[(1R)-1-(6-methoxy-3-pyridinyl)ethyl]benzamide |
| SMILES | CCCCS(=O)Nc1ccccc1C(=O)N[C@H](C)c1ccc(OC)nc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-4-5-12-26(24)22-17-9-7-6-8-16(17)19(23)21-14(2)15-10-11-18(25-3)20-13-15/h6-11,13-14,22H,4-5,12H2,1-3H3,(H,21,23)/t14-,26?/m1/s1 |
| InChIKey | RHWKNDQBDPNSIG-ZUXKRAEMSA-N |
| XLogP | 3.46 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |