About 4-(dimethylamino)butanal;methanamine
4-(dimethylamino)butanal;methanamine (PubChem CID 143016014) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is 4-(dimethylamino)butanal;methanamine.
Molecular Properties
| Compound Name | 4-(dimethylamino)butanal;methanamine |
| PubChem CID | 143016014 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 4-(dimethylamino)butanal;methanamine |
| SMILES | CN.CN(C)CCCC=O |
| InChI | InChI=1S/C6H13NO.CH5N/c1-7(2)5-3-4-6-8;1-2/h6H,3-5H2,1-2H3;2H2,1H3 |
| InChIKey | VBCOIKISDNAIQL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)butanal;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)butanal;methanamine?
The IUPAC name of 4-(dimethylamino)butanal;methanamine (CID 143016014) is 4-(dimethylamino)butanal;methanamine.
What is the SMILES notation for 4-(dimethylamino)butanal;methanamine?
The canonical SMILES for 4-(dimethylamino)butanal;methanamine is CN.CN(C)CCCC=O.
What is the InChIKey of 4-(dimethylamino)butanal;methanamine?
The InChIKey is VBCOIKISDNAIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.CH5N/c1-7(2)5-3-4-6-8;1-2/h6H,3-5H2,1-2H3;2H2,1H3.
What are the key properties of 4-(dimethylamino)butanal;methanamine?
4-(dimethylamino)butanal;methanamine has a molecular weight of 146.23 g/mol, XLogP of 0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)butanal;methanamine is sourced from PubChem (CID 143016014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).