C8H17F2NO — CID 143016235
5-(dimethylamino)-1,1-difluoro-3-methylpentan-2-ol (PubChem CID 143016235) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-(dimethylamino)-1,1-difluoro-3-methylpentan-2-ol.
| Compound Name | 5-(dimethylamino)-1,1-difluoro-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 143016235 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 5-(dimethylamino)-1,1-difluoro-3-methylpentan-2-ol |
| SMILES | CC(CCN(C)C)C(O)C(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-6(4-5-11(2)3)7(12)8(9)10/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | XKTQOJXSQSDPMY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |