About (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol
(2S)-5-(ethylamino)-1,1-difluoropentan-2-ol (PubChem CID 143016302) has the molecular formula C7H15F2NO
and a molecular weight of 167.20 g/mol. Its IUPAC name is (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol.
Molecular Properties
| Compound Name | (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol |
| PubChem CID | 143016302 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol |
| SMILES | CCNCCC[C@H](O)C(F)F |
| InChI | InChI=1S/C7H15F2NO/c1-2-10-5-3-4-6(11)7(8)9/h6-7,10-11H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | GVWVKQAWWDQZQB-LURJTMIESA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol?
The IUPAC name of (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol (CID 143016302) is (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol.
What is the SMILES notation for (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol?
The canonical SMILES for (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol is CCNCCC[C@H](O)C(F)F.
What is the InChIKey of (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol?
The InChIKey is GVWVKQAWWDQZQB-LURJTMIESA-N. The full InChI is InChI=1S/C7H15F2NO/c1-2-10-5-3-4-6(11)7(8)9/h6-7,10-11H,2-5H2,1H3/t6-/m0/s1.
What are the key properties of (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol?
(2S)-5-(ethylamino)-1,1-difluoropentan-2-ol has a molecular weight of 167.20 g/mol, XLogP of 1.00, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-(ethylamino)-1,1-difluoropentan-2-ol is sourced from PubChem (CID 143016302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).