About ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol (PubChem CID 143016464) has the molecular formula C17H31NO3
and a molecular weight of 297.44 g/mol. Its IUPAC name is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol.
Molecular Properties
| Compound Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol |
| PubChem CID | 143016464 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol |
| SMILES | C=C/C=C(\C=C)COC=O.CC.CC(O)C1CCN(C)C1 |
| InChI | InChI=1S/C8H10O2.C7H15NO.C2H6/c1-3-5-8(4-2)6-10-7-9;1-6(9)7-3-4-8(2)5-7;1-2/h3-5,7H,1-2,6H2;6-7,9H,3-5H2,1-2H3;1-2H3/b8-5+;; |
| InChIKey | JDDXMBAFQZNZSY-RMZRELHQSA-N |
| XLogP | 2.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol?
The IUPAC name of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol (CID 143016464) is ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol.
What is the SMILES notation for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol?
The canonical SMILES for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol is C=C/C=C(\C=C)COC=O.CC.CC(O)C1CCN(C)C1.
What is the InChIKey of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol?
The InChIKey is JDDXMBAFQZNZSY-RMZRELHQSA-N. The full InChI is InChI=1S/C8H10O2.C7H15NO.C2H6/c1-3-5-8(4-2)6-10-7-9;1-6(9)7-3-4-8(2)5-7;1-2/h3-5,7H,1-2,6H2;6-7,9H,3-5H2,1-2H3;1-2H3/b8-5+;;.
What are the key properties of ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol?
ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol has a molecular weight of 297.44 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2E)-2-ethenylpenta-2,4-dienyl] formate;1-(1-methylpyrrolidin-3-yl)ethanol is sourced from PubChem (CID 143016464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).